Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C166670-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,291.90
|
|
Discover 2-Chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine by Aladdin Scientific in for only $2,291.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-Chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine | 1241950-75-3 | DTXSID40673858 | MFCD11857676 | AKOS015851335 | CS-0174056 | FT-0717664 | 1-(2-FURYLMETHYL)-5-OXOPYRROLIDINE-3-CARBOXYLICACID | 2-chloro-4-iodo-3-(4,4,5,5-tetramethyl-[1,3,2]dioxabor |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Polyhalopyridines |
| Alternative Parents | 2-halopyridines Aryl chlorides Aryl iodides Boronic acid esters Dioxaborolanes Heteroaromatic compounds Oxacyclic compounds Azacyclic compounds Organic metalloid salts Organochlorides Organoiodides Organonitrogen compounds Organopnictogen compounds Hydrocarbon derivatives Organooxygen compounds Organoboron compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Polyhalopyridine - 2-halopyridine - Aryl chloride - Aryl halide - Aryl iodide - Boronic acid ester - 1,3,2-dioxaborolane - Heteroaromatic compound - Boronic acid derivative - Organic metalloid salt - Azacycle - Oxacycle - Hydrocarbon derivative - Organic salt - Organooxygen compound - Organonitrogen compound - Organoiodide - Organochloride - Organoboron compound - Organohalogen compound - Organic nitrogen compound - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as polyhalopyridines. These are organic compounds containing a pyridine ring substituted at two or more positions by a halogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-chloro-4-iodo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| INCHI | InChI=1S/C11H14BClINO2/c1-10(2)11(3,4)17-12(16-10)8-7(14)5-6-15-9(8)13/h5-6H,1-4H3 |
| InChIKey | YREHTQZLXDCHCP-UHFFFAOYSA-N |
| Smiles | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2Cl)I |
| Isomeric SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2Cl)I |
| WGK Germany | 3 |
| PubChem CID | 46736771 |
| Molecular Weight | 365.4 |
| Molecular Weight | 365.400 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 364.985 Da |
| Monoisotopic Mass | 364.985 Da |
| Topological Polar Surface Area | 31.400 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 287.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |