C2009148Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
Basic Description
| Synonyms | 2-Bromopropene, 99% | Isopropenyl bromide | UNII-C8GT7P5ZZS | BRN 1731926 | 2-BROMOPROPENE | 2-Bromo-propene | AKOS015968899 | DTXSID8060325 | FT-0611603 | InChI=1/C3H5Br/c1-3(2)4/h1H2,2H | 2-Bromopropylene | AMY955 | 2-bromanylprop-1-ene | C8GT7P5ZZS | N |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at -20°C,Argon charged |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomic Classification
Taxonomy Tree
-
Kingdom
Organic compounds
-
Superclass
Organohalogen compounds
-
Class
Vinyl halides
- Subclass Vinyl bromides
-
Class
Vinyl halides
-
Superclass
Organohalogen compounds
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Vinyl halides |
| Subclass | Vinyl bromides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Vinyl bromides |
| Alternative Parents | Bromoalkenes Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Bromoalkene - Haloalkene - Vinyl bromide - Hydrocarbon derivative - Organobromide - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as vinyl bromides. These are vinyl halides in which a bromine atom is bonded to an sp2-hybridised carbon atom. |
| External Descriptors | Not available |
|
|
|
Names and Identifiers
| Pubchem Sid | 504752083 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504752083 |
| IUPAC Name | 2-bromoprop-1-ene |
| INCHI | InChI=1S/C3H5Br/c1-3(2)4/h1H2,2H3 |
| InChIKey | PHMRPWPDDRGGGF-UHFFFAOYSA-N |
| Smiles | CC(=C)Br |
| Isomeric SMILES | CC(=C)Br |
| WGK Germany | 3 |
| RTECS | UC7085000 |
| Molecular Weight | 120.98 |
| Beilstein | 1731926 |
| Reaxy-Rn | 1731926 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1731926&ln= |
Certificates（CoA,COO,BSE/TSE and Analysis Chart)
C of A & Other Certificates(BSE/TSE, COO):
Analytical Chart:
Chemical and Physical Properties
| Solubility | Immiscible with water. |
|---|---|
| Sensitivity | air &light & heat sensitive |
| Refractive Index | 1.4436 |
| Flash Point(°F) | 39.2 °F |
| Flash Point(°C) | 4°(39°F) |
| Boil Point(°C) | 48°C |
| Melt Point(°C) | -87°C |
| Molecular Weight | 120.980 g/mol |
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 119.957 Da |
| Monoisotopic Mass | 119.957 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 4 |
| Formal Charge | 0 |
| Complexity | 30.300 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Solution Calculators
Reviews
Customer Reviews
Remind me later