Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B473768-1g
|
1g |
3
|
$184.90
|
|
|
B473768-5g
|
5g |
3
|
$799.90
|
|
| Synonyms | NHS-BiB | AS-83254 | 2,5-DIOXOPYRROLIDIN-1-YL 2-BROMO-2-METHYLPROPANOATE | 2-Bromoisobutanoic acid N-hydroxysuccinimide ester | SCHEMBL260599 | NHS-BiB | Propanoic acid, 2-bromo-2-methyl-, 2,5-dioxo-1-pyrrolidinyl ester | (2,5-dioxopyrrolidin-1-yl) 2-brom |
|---|---|
| Specifications & Purity | ≥98%(GC) |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
| Product Description |
Description Atom transfer radical polymerization (ATRP) initiator with an NHS ester moiety for conjugation chemistry, useful for biological ligations. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyrrolidines |
| Subclass | Pyrrolidones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolidine-2-ones |
| Alternative Parents | Dicarboximides Alpha-halocarboxylic acid derivatives Lactams Monocarboxylic acids and derivatives Azacyclic compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl bromides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | 2-pyrrolidone - Alpha-halocarboxylic acid derivative - Alpha-halocarboxylic acid or derivatives - Dicarboximide - Lactam - Carboxylic acid derivative - Azacycle - Monocarboxylic acid or derivatives - Alkyl bromide - Organobromide - Organohalogen compound - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrrolidine-2-ones. These are pyrrolidines which bear a C=O group at position 2 of the pyrrolidine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-bromo-2-methylpropanoate |
|---|---|
| INCHI | InChI=1S/C8H10BrNO4/c1-8(2,9)7(13)14-10-5(11)3-4-6(10)12/h3-4H2,1-2H3 |
| InChIKey | QBJWGGWPQPRVKW-UHFFFAOYSA-N |
| Smiles | CC(C)(C(=O)ON1C(=O)CCC1=O)Br |
| Isomeric SMILES | CC(C)(C(=O)ON1C(=O)CCC1=O)Br |
| Molecular Weight | 264.07 |
| Reaxy-Rn | 9847467 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=9847467&ln= |
| Sensitivity | Heat sensitive;Moisture sensitive |
|---|---|
| Flash Point(°F) | Not applicable |
| Flash Point(°C) | Not applicable |
| Melt Point(°C) | 135-140℃ |
| Molecular Weight | 264.070 g/mol |
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 262.979 Da |
| Monoisotopic Mass | 262.979 Da |
| Topological Polar Surface Area | 63.700 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 284.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $23.90