Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B165770-1g
|
1g |
5
|
$130.90
|
|
|
B165770-5g
|
5g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$582.90
|
|
| Synonyms | 1072951-95-1 | 2-Bromo-3-butoxy-6-fluorophenylboronic acid | (2-Bromo-3-butoxy-6-fluorophenyl)boronic acid | SCHEMBL9893705 | DTXSID90584763 | MFCD08276824 | AKOS015834845 | BS-22847 | CS-0175923 | (2-Bromo-3-butoxy-6-fluorophenyl)boronicacid | D71445 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Phenoxy compounds Fluorobenzenes Bromobenzenes Alkyl aryl ethers Aryl fluorides Aryl bromides Boronic acids Organic metalloid salts Organofluorides Organobromides Organoboron compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Phenol ether - Alkyl aryl ether - Bromobenzene - Fluorobenzene - Halobenzene - Aryl bromide - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Boronic acid - Boronic acid derivative - Organic metalloid salt - Ether - Organohalogen compound - Organic salt - Hydrocarbon derivative - Organic oxygen compound - Organoboron compound - Organobromide - Organofluoride - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504768316 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504768316 |
| IUPAC Name | (2-bromo-3-butoxy-6-fluorophenyl)boronic acid |
| INCHI | InChI=1S/C10H13BBrFO3/c1-2-3-6-16-8-5-4-7(13)9(10(8)12)11(14)15/h4-5,14-15H,2-3,6H2,1H3 |
| InChIKey | RMDWMUWZAKPUFW-UHFFFAOYSA-N |
| Smiles | B(C1=C(C=CC(=C1Br)OCCCC)F)(O)O |
| Isomeric SMILES | B(C1=C(C=CC(=C1Br)OCCCC)F)(O)O |
| WGK Germany | 3 |
| Molecular Weight | 290.92 |
| Reaxy-Rn | 49574853 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=49574853&ln= |
| Molecular Weight | 290.920 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 290.013 Da |
| Monoisotopic Mass | 290.013 Da |
| Topological Polar Surface Area | 49.700 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 209.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |