Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B170296-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$499.90
|
|
| Synonyms | 42445-46-5 | 4-(Methylthio)phenacyl bromide | 2-bromo-1-(4-methylsulfanylphenyl)ethanone | 2-bromo-1-(4-(methylthio)phenyl)ethanone | 2-bromo-1-[4-(methylsulfanyl)phenyl]ethan-1-one | MFCD03094708 | 2-bromo-1-[4-(methylthio)phenyl]ethanone | 2-bromo-1-[4-(methylsulfany |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Alkyl-phenylketones |
| Alternative Parents | Thiophenol ethers Benzoyl derivatives Aryl alkyl ketones Alkylarylthioethers Alpha-haloketones Sulfenyl compounds Organobromides Organic oxides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkyl-phenylketone - Benzoyl - Thiophenol ether - Aryl alkyl ketone - Aryl thioether - Alkylarylthioether - Benzenoid - Monocyclic benzene moiety - Alpha-haloketone - Sulfenyl compound - Thioether - Alkyl halide - Organosulfur compound - Organobromide - Organohalogen compound - Alkyl bromide - Hydrocarbon derivative - Organic oxide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl-phenylketones. These are aromatic compounds containing a ketone substituted by one alkyl group, and a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-bromo-1-(4-methylsulfanylphenyl)ethanone |
|---|---|
| INCHI | InChI=1S/C9H9BrOS/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5H,6H2,1H3 |
| InChIKey | YSSYIJBAPDTSAY-UHFFFAOYSA-N |
| Smiles | CSC1=CC=C(C=C1)C(=O)CBr |
| Isomeric SMILES | CSC1=CC=C(C=C1)C(=O)CBr |
| Molecular Weight | 245.14 |
| Reaxy-Rn | 776200 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=776200&ln= |
| Molecular Weight | 245.140 g/mol |
|---|---|
| XLogP3 | 2.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 243.956 Da |
| Monoisotopic Mass | 243.956 Da |
| Topological Polar Surface Area | 42.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 153.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |