Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B182375-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,132.90
|
|
| Synonyms | 1889-78-7 | 2-bromo-1-(4-chlorophenyl)-2-phenylethan-1-one | 2-bromo-1-(4-chlorophenyl)-2-phenylethanone | Ethanone, 2-bromo-1-(4-chlorophenyl)-2-phenyl- | 1-(4-chlorophenyl)-2-bromo-2-phenylethanone | 2-bromo-1-(4-chlorophenyl)-2-phenyl-ethanone | SCHEMBL627839 | DTXS |
|---|---|
| Specifications & Purity | ≥96% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Phenylpropanoids and polyketides |
| Class | Stilbenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Stilbenes |
| Alternative Parents | Alkyl-phenylketones Benzoyl derivatives Aryl alkyl ketones Chlorobenzenes Aryl chlorides Alpha-haloketones Organochlorides Organobromides Organic oxides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Stilbene - Alkyl-phenylketone - Phenylketone - Aryl alkyl ketone - Aryl ketone - Benzoyl - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Alpha-haloketone - Ketone - Alkyl bromide - Organohalogen compound - Organobromide - Organochloride - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Alkyl halide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as stilbenes. These are organic compounds containing a 1,2-diphenylethylene moiety. Stilbenes (C6-C2-C6 ) are derived from the common phenylpropene (C6-C3) skeleton building block. The introduction of one or more hydroxyl groups to a phenyl ring lead to stilbenoids. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-bromo-1-(4-chlorophenyl)-2-phenylethanone |
|---|---|
| INCHI | InChI=1S/C14H10BrClO/c15-13(10-4-2-1-3-5-10)14(17)11-6-8-12(16)9-7-11/h1-9,13H |
| InChIKey | OBEFSOTWERFWSZ-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)Cl)Br |
| Isomeric SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)Cl)Br |
| Molecular Weight | 309.6 |
| Reaxy-Rn | 1214591 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1214591&ln= |
| Molecular Weight | 309.580 g/mol |
|---|---|
| XLogP3 | 4.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 307.96 Da |
| Monoisotopic Mass | 307.96 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 255.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |