Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A465864-10ml
|
10ml |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$353.90
|
|
| Synonyms | o-Methoxyphenyl azide | XBXJQBGKICADKR-UHFFFAOYSA-N | methoxyphenyl azide | STL192401 | F2157-0473 | AKOS015830668 | 1-Azido-2-methoxybenzene | DTXSID50341975 | Benzene, 1-azido-2-methoxy- | LS-12259 | Anisole, o-azido- | EN300-112612 | o-Azidoanisole | S |
|---|---|
| Specifications & Purity | ≥95%(HPLC), 0.5M in tert-butyl methyl ether |
| Storage Temp | Store at -20°C |
| Shipped In |
Ice chest + Ice pads This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Aniline and substituted anilines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Methoxyanilines |
| Alternative Parents | Phenylazides Phenoxy compounds Methoxybenzenes Anisoles Alkyl aryl ethers Azo imides Azo compounds Organic salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Methoxyaniline - Anisole - Phenol ether - Phenylazide - Methoxybenzene - Phenoxy compound - Alkyl aryl ether - Azo compound - Azo imide - Ether - Organic salt - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxygen compound - Organic cation - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as methoxyanilines. These are organic compound containing an aniline group substituted at one or more positions by a methoxy group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-azido-2-methoxybenzene |
|---|---|
| INCHI | InChI=1S/C7H7N3O/c1-11-7-5-3-2-4-6(7)9-10-8/h2-5H,1H3 |
| InChIKey | XBXJQBGKICADKR-UHFFFAOYSA-N |
| Smiles | COC1=CC=CC=C1N=[N+]=[N-] |
| Isomeric SMILES | COC1=CC=CC=C1N=[N+]=[N-] |
| WGK Germany | 3 |
| Molecular Weight | 149.15 |
| Reaxy-Rn | 2091723 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2091723&ln= |
| Flash Point(°F) | -27.4 °F |
|---|---|
| Flash Point(°C) | -33 °C |
| Molecular Weight | 149.150 g/mol |
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 149.059 Da |
| Monoisotopic Mass | 149.059 Da |
| Topological Polar Surface Area | 23.600 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 165.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |