Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A175909-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,219.90
|
|
Discover 2-Azetidinecarboxylic acid, 1-propyl-, (2S)- by Aladdin Scientific in 97% for only $2,219.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 255882-97-4 | 2-Azetidinecarboxylic acid, 1-propyl-, (2S)- | (S)-1-Propylazetidine-2-carboxylic acid | (2S)-1-Propyl-2-azetidinecarboxylic acid | (2S)-1-Propylazetidine-2-carboxylic acid | MFCD29472375 | SCHEMBL5701854 | DTXSID501259607 | AKOS030628384 | (S)-1-Propylazetid |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives - Alpha amino acids |
| Direct Parent | L-alpha-amino acids |
| Alternative Parents | Azetidinecarboxylic acids Trialkylamines Amino acids Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | L-alpha-amino acid - Azetidinecarboxylic acid - Azetidine - Tertiary amine - Tertiary aliphatic amine - Amino acid - Azacycle - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Carboxylic acid - Organic nitrogen compound - Amine - Organooxygen compound - Organonitrogen compound - Carbonyl group - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2S)-1-propylazetidine-2-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C7H13NO2/c1-2-4-8-5-3-6(8)7(9)10/h6H,2-5H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | ODBYTJNDVJFYSS-LURJTMIESA-N |
| Smiles | CCCN1CCC1C(=O)O |
| Isomeric SMILES | CCCN1CC[C@H]1C(=O)O |
| Molecular Weight | 143.1836 |
| Reaxy-Rn | 33750366 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=33750366&ln= |
| Molecular Weight | 143.180 g/mol |
|---|---|
| XLogP3 | -1.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 143.095 Da |
| Monoisotopic Mass | 143.095 Da |
| Topological Polar Surface Area | 40.500 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 136.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |