Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A186291-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,803.90
|
|
| Synonyms | 5-(P-tolyl)thiazol-2-amine | 73040-54-7 | 2-AMINO-5-(P-TOLYL)THIAZOLE | 5-(4-methylphenyl)-1,3-thiazol-2-amine | 5-p-tolylthiazol-2-amine | Oprea1_085255 | SCHEMBL3500308 | DTXSID70359370 | BHSKUJCHFMAMKF-UHFFFAOYSA-N | YCA04054 | MFCD00858269 | STL196758 | AKOS002341963 | BS-2437 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Thiazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2,5-disubstituted thiazoles |
| Alternative Parents | Toluenes 2-amino-1,3-thiazoles Heteroaromatic compounds Azacyclic compounds Primary amines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Toluene - 2,5-disubstituted 1,3-thiazole - 1,3-thiazol-2-amine - Benzenoid - Monocyclic benzene moiety - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 2,5-disubstituted thiazoles. These are compounds containing a thiazole ring substituted at positions 2 and 5 only. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-(4-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| INCHI | InChI=1S/C10H10N2S/c1-7-2-4-8(5-3-7)9-6-12-10(11)13-9/h2-6H,1H3,(H2,11,12) |
| InChIKey | BHSKUJCHFMAMKF-UHFFFAOYSA-N |
| Smiles | CC1=CC=C(C=C1)C2=CN=C(S2)N |
| Isomeric SMILES | CC1=CC=C(C=C1)C2=CN=C(S2)N |
| Molecular Weight | 190.3 |
| Reaxy-Rn | 975453 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=975453&ln= |
| Molecular Weight | 190.270 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 190.056 Da |
| Monoisotopic Mass | 190.056 Da |
| Topological Polar Surface Area | 67.200 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 166.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |