Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A300848-250mg
|
250mg |
3
|
$89.90
|
|
|
A300848-1g
|
1g |
3
|
$136.90
|
|
| Synonyms | 2-Amino-4-methylpyrimidine-5-carboxylic acid | 769-51-7 | 2-Amino-4-methyl-pyrimidine-5-carboxylic acid | BAS 07567147 | SCHEMBL1540141 | DTXSID10390085 | BBL011823 | MFCD05237187 | STL163405 | AKOS000111553 | PS-5720 | SB56029 | 2-Amino-4-methylpyrimidine-5-carboxylicacid | BB 02 |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrimidines and pyrimidine derivatives |
| Intermediate Tree Nodes | Pyrimidinecarboxylic acids and derivatives |
| Direct Parent | Pyrimidinecarboxylic acids |
| Alternative Parents | Aminopyrimidines and derivatives Heteroaromatic compounds Amino acids Carboxylic acids Azacyclic compounds Primary amines Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrimidine-5-carboxylic acid - Aminopyrimidine - Heteroaromatic compound - Amino acid or derivatives - Amino acid - Carboxylic acid derivative - Carboxylic acid - Azacycle - Amine - Primary amine - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrimidinecarboxylic acids. These are pyrimidines with a structure containing a carboxyl group attached to the pyrimidine ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504762487 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504762487 |
| IUPAC Name | 2-amino-4-methylpyrimidine-5-carboxylic acid |
| INCHI | InChI=1S/C6H7N3O2/c1-3-4(5(10)11)2-8-6(7)9-3/h2H,1H3,(H,10,11)(H2,7,8,9) |
| InChIKey | DUWNUQBBVGEJPV-UHFFFAOYSA-N |
| Smiles | CC1=NC(=NC=C1C(=O)O)N |
| Isomeric SMILES | CC1=NC(=NC=C1C(=O)O)N |
| Molecular Weight | 153.13 |
| Reaxy-Rn | 137869 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=137869&ln= |
| Molecular Weight | 153.140 g/mol |
|---|---|
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 153.054 Da |
| Monoisotopic Mass | 153.054 Da |
| Topological Polar Surface Area | 89.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 162.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |