Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A184198-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$321.90
|
|
Discover 2-Amino-4-methoxybenzamide by Aladdin Scientific in 98% for only $321.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-Amino-4-methoxybenzamide | 38487-91-1 | 2-amino-4-methoxy-benzamide | Benzamide, 2-amino-4-methoxy | Benzamide, 2-amino-4-methoxy- | 4-methoxy-anthranilamide | 4-methoxy-2-aminobenzamide | 4-methoxy-2-amino-benzamide | SCHEMBL148855 | 2-amino-4-(methyloxy)benzamide | DTXSI |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Benzamides |
| Direct Parent | Anthranilamides |
| Alternative Parents | 2-aminobenzamides Methoxyanilines Aminophenyl ethers Phenoxy compounds Methoxybenzenes Benzoyl derivatives Anisoles Alkyl aryl ethers Vinylogous amides Primary carboxylic acid amides Amino acids and derivatives Primary amines Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 2-aminobenzamide - Anthranilamide - Aminobenzoic acid or derivatives - Aminobenzamide - Methoxyaniline - Aminophenyl ether - Phenoxy compound - Methoxybenzene - Aniline or substituted anilines - Anisole - Phenol ether - Benzoyl - Alkyl aryl ether - Vinylogous amide - Primary carboxylic acid amide - Carboxamide group - Amino acid or derivatives - Carboxylic acid derivative - Ether - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Primary amine - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as anthranilamides. These are aromatic compound containing a benzene carboxamide moiety that carries an amine group at the 2-position of the benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-amino-4-methoxybenzamide |
|---|---|
| INCHI | InChI=1S/C8H10N2O2/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4H,9H2,1H3,(H2,10,11) |
| InChIKey | FNXZMHNQECQCNX-UHFFFAOYSA-N |
| Smiles | COC1=CC(=C(C=C1)C(=O)N)N |
| Isomeric SMILES | COC1=CC(=C(C=C1)C(=O)N)N |
| Molecular Weight | 166.2 |
| Reaxy-Rn | 2209648 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2209648&ln= |
| Molecular Weight | 166.180 g/mol |
|---|---|
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 166.074 Da |
| Monoisotopic Mass | 166.074 Da |
| Topological Polar Surface Area | 78.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 172.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |