Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A169303-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,941.90
|
|
Discover 2-Amino-4-chloro-5-methyl-benzonitrile by Aladdin Scientific in for only $1,941.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 289686-80-2 | 2-AMINO-4-CHLORO-5-METHYLBENZONITRILE | 2-amino-4-chloro-5-methyl-benzonitrile | 2-Cyano-5-chloro-4-methylaniline | SCHEMBL404910 | DTXSID50445987 | UUWBRWXXBHDPMM-UHFFFAOYSA-N | 5-chloro-2-cyano-4-methylaniline | AB3018 | MFCD08437620 | AKOS006290621 | SB36404 | A |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzonitriles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzonitriles |
| Alternative Parents | Aniline and substituted anilines Aminotoluenes Chlorobenzenes Aryl chlorides Nitriles Primary amines Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzonitrile - Aniline or substituted anilines - Aminotoluene - Chlorobenzene - Halobenzene - Toluene - Aryl halide - Aryl chloride - Nitrile - Carbonitrile - Primary amine - Organonitrogen compound - Organochloride - Organohalogen compound - Amine - Organic nitrogen compound - Cyanide - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzonitriles. These are organic compounds containing a benzene bearing a nitrile substituent. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-amino-4-chloro-5-methylbenzonitrile |
|---|---|
| INCHI | InChI=1S/C8H7ClN2/c1-5-2-6(4-10)8(11)3-7(5)9/h2-3H,11H2,1H3 |
| InChIKey | UUWBRWXXBHDPMM-UHFFFAOYSA-N |
| Smiles | CC1=CC(=C(C=C1Cl)N)C#N |
| Isomeric SMILES | CC1=CC(=C(C=C1Cl)N)C#N |
| Molecular Weight | 166.61 |
| Reaxy-Rn | 9191484 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=9191484&ln= |
| Molecular Weight | 166.610 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 166.03 Da |
| Monoisotopic Mass | 166.03 Da |
| Topological Polar Surface Area | 49.800 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 184.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |