Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A176706-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$49.90
|
|
Discover 2-amino-2-(oxan-4-yl)acetic acid by Aladdin Scientific in 97% for only $49.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 53284-84-7 | 2-amino-2-(tetrahydro-2h-pyran-4-yl)acetic acid | 4'-Tetrahydropyranylglycine | 2-amino-2-(oxan-4-yl)acetic Acid | 4-TETRAHYDROPYRANYLGLYCINE | 2-(Tetrahydropyran-4-yl)glycine | amino-(tetrahydro-pyran-4-yl)-acetic acid | 2H-Pyran-4-acetic acid,a-aminotetr |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alpha amino acids |
| Alternative Parents | Oxanes Amino acids Oxacyclic compounds Monocarboxylic acids and derivatives Dialkyl ethers Carboxylic acids Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Alpha-amino acid - Oxane - Amino acid - Carboxylic acid - Dialkyl ether - Ether - Oxacycle - Organoheterocyclic compound - Monocarboxylic acid or derivatives - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Primary amine - Primary aliphatic amine - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Carbonyl group - Amine - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alpha amino acids. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon). |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-amino-2-(oxan-4-yl)acetic acid |
|---|---|
| INCHI | InChI=1S/C7H13NO3/c8-6(7(9)10)5-1-3-11-4-2-5/h5-6H,1-4,8H2,(H,9,10) |
| InChIKey | XLZJPHKIECMDPG-UHFFFAOYSA-N |
| Smiles | C1COCCC1C(C(=O)O)N |
| Isomeric SMILES | C1COCCC1C(C(=O)O)N |
| Molecular Weight | 159.185 |
| Reaxy-Rn | 125369 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=125369&ln= |
| Molecular Weight | 159.180 g/mol |
|---|---|
| XLogP3 | -2.800 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 159.09 Da |
| Monoisotopic Mass | 159.09 Da |
| Topological Polar Surface Area | 72.600 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 143.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |