Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D290375-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,267.90
|
|
| Synonyms | 357645-37-5 | 2,7-DIBROMO-9,9-BIS(4-METHYLPHENYL)-9H-FLUORENE | 2,7-Dibromo-9,9-di-p-tolyl-9H-fluorene | 2,7-dibromo-9,9-bis(4-methylphenyl)fluorene | SCHEMBL13567251 | DTXSID70694738 | SB66705 | CS-0435317 | FT-0746258 |
|---|---|
| Specifications & Purity | ≥98%(HPLC) |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Biphenyls and derivatives |
| Intermediate Tree Nodes | Brominated biphenyls |
| Direct Parent | Polybrominated biphenyls |
| Alternative Parents | Fluorenes Toluenes Aryl bromides Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Polybrominated biphenyl - Fluorene - Toluene - Aryl halide - Aryl bromide - Hydrocarbon derivative - Organobromide - Organohalogen compound - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as polybrominated biphenyls. These are organic aromatic compounds containing a biphenyl moiety, which is substituted at two or more ring positions by a bromine atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,7-dibromo-9,9-bis(4-methylphenyl)fluorene |
|---|---|
| INCHI | InChI=1S/C27H20Br2/c1-17-3-7-19(8-4-17)27(20-9-5-18(2)6-10-20)25-15-21(28)11-13-23(25)24-14-12-22(29)16-26(24)27/h3-16H,1-2H3 |
| InChIKey | HPFNUQVVMXXYOV-UHFFFAOYSA-N |
| Smiles | CC1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br)C5=CC=C(C=C5)C |
| Isomeric SMILES | CC1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br)C5=CC=C(C=C5)C |
| Reaxy-Rn | 8866710 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=8866710&ln= |
| Molecular Weight | 504.300 g/mol |
|---|---|
| XLogP3 | 8.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 2 |
| Exact Mass | 503.991 Da |
| Monoisotopic Mass | 501.993 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 29 |
| Formal Charge | 0 |
| Complexity | 507.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |