Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D165858-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$605.90
|
|
| Synonyms | MFCD11857637 | AKOS015853831 | FT-0702388 | DTXSID20670143 | 1087659-27-5 | 2,6-Diiodo-5-methoxypyridin-3-ol | 2,6-Diiodo-5-methoxypyridin-3-ol, AldrichCPR |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Polyhalopyridines |
| Alternative Parents | Hydroxypyridines Alkyl aryl ethers 2-halopyridines Aryl iodides Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organoiodides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Polyhalopyridine - Alkyl aryl ether - Hydroxypyridine - 2-halopyridine - Aryl iodide - Aryl halide - Heteroaromatic compound - Azacycle - Ether - Hydrocarbon derivative - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organoiodide - Organohalogen compound - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as polyhalopyridines. These are organic compounds containing a pyridine ring substituted at two or more positions by a halogen atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,6-diiodo-5-methoxypyridin-3-ol |
|---|---|
| INCHI | InChI=1S/C6H5I2NO2/c1-11-4-2-3(10)5(7)9-6(4)8/h2,10H,1H3 |
| InChIKey | CAXKKABEHHHUEV-UHFFFAOYSA-N |
| Smiles | COC1=C(N=C(C(=C1)O)I)I |
| Isomeric SMILES | COC1=C(N=C(C(=C1)O)I)I |
| WGK Germany | 3 |
| PubChem CID | 45361762 |
| Molecular Weight | 376.92 |
| Molecular Weight | 376.920 g/mol |
|---|---|
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 376.841 Da |
| Monoisotopic Mass | 376.841 Da |
| Topological Polar Surface Area | 42.400 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 136.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |