Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D176784-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$76.90
|
|
| Synonyms | 55304-83-1 | 2,6-DIBROMONICOTINALDEHYDE | 2,6-Dibromopyridine-3-carbaldehyde | 2,6-Dibromopyridine-3-carboxaldehyde | MFCD10574710 | 2,6-dibromo-3-formylpyridine | SCHEMBL3102823 | DTXSID90482811 | GSFFLGODLKMVMT-UHFFFAOYSA-N | AKOS015966288 | AM90110 | PB20462 | AS-33634 | SY0972 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | Pyridine carboxaldehydes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridine carboxaldehydes |
| Alternative Parents | Polyhalopyridines Aryl-aldehydes 2-halopyridines Aryl bromides Vinylogous halides Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 3-pyridine carboxaldehyde - Polyhalopyridine - 2-halopyridine - Aryl-aldehyde - Aryl bromide - Aryl halide - Vinylogous halide - Heteroaromatic compound - Azacycle - Aldehyde - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyridine carboxaldehydes. These are aromatic compounds containing a pyridine ring which bears a carboxaldehyde group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,6-dibromopyridine-3-carbaldehyde |
|---|---|
| INCHI | InChI=1S/C6H3Br2NO/c7-5-2-1-4(3-10)6(8)9-5/h1-3H |
| InChIKey | GSFFLGODLKMVMT-UHFFFAOYSA-N |
| Smiles | C1=CC(=NC(=C1C=O)Br)Br |
| Isomeric SMILES | C1=CC(=NC(=C1C=O)Br)Br |
| Molecular Weight | 264.904 |
| Reaxy-Rn | 1525174 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1525174&ln= |
| Molecular Weight | 264.900 g/mol |
|---|---|
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 264.856 Da |
| Monoisotopic Mass | 262.858 Da |
| Topological Polar Surface Area | 30.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 131.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $91.90