Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D187015-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,302.90
|
|
Discover 2,6-Dibromo-3-methoxyphenylboronic acid by Aladdin Scientific in 97% for only $1,302.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2,6-Dibromo-3-methoxyphenylboronic acid | 850567-93-0 | (2,6-Dibromo-3-methoxyphenyl)boronic acid | (2,6-Dibromo-5-methoxy)benzeneboronic acid | 2,6-DIBROMO-3-METHOXYBENZENEBORONIC ACID | (2,6-DIBROMO-5-METHOXY)BENZENEBORONICACID | SCHEMBL13125399 | DTXSID40656863 | MFCD |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Bromobenzenes Alkyl aryl ethers Aryl bromides Boronic acids Organic metalloid salts Organometalloid compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Anisole - Methoxybenzene - Alkyl aryl ether - Bromobenzene - Halobenzene - Aryl bromide - Aryl halide - Monocyclic benzene moiety - Boronic acid - Boronic acid derivative - Ether - Organic metalloid salt - Organooxygen compound - Hydrocarbon derivative - Organic oxygen compound - Organohalogen compound - Organic metalloid moeity - Organobromide - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | (2,6-dibromo-3-methoxyphenyl)boronic acid |
|---|---|
| INCHI | InChI=1S/C7H7BBr2O3/c1-13-5-3-2-4(9)6(7(5)10)8(11)12/h2-3,11-12H,1H3 |
| InChIKey | CCRLWBYZCYCUAK-UHFFFAOYSA-N |
| Smiles | B(C1=C(C=CC(=C1Br)OC)Br)(O)O |
| Isomeric SMILES | B(C1=C(C=CC(=C1Br)OC)Br)(O)O |
| Molecular Weight | 309.7 |
| Reaxy-Rn | 26979691 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=26979691&ln= |
| Molecular Weight | 309.750 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 309.883 Da |
| Monoisotopic Mass | 307.885 Da |
| Topological Polar Surface Area | 49.700 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 170.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |