Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B181958-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,566.90
|
|
| Synonyms | 2,6-bis(benzyloxy)pyridine | 16727-46-1 | 2,6-bis(phenylmethoxy)pyridine | MFCD05863260 | Pyridine, 2,6-bis(phenylmethoxy)- | 2,6-dibenzyloxypyridine | SCHEMBL2524154 | DTXSID60356136 | IREZYNKPQCIUME-UHFFFAOYSA-N | AKOS015839445 | BS-21688 | SY333706 | CS-0211442 | D97744 | A882258 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkyl aryl ethers |
| Alternative Parents | Pyridines and derivatives Benzene and substituted derivatives Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkyl aryl ether - Benzenoid - Pyridine - Monocyclic benzene moiety - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkyl aryl ethers. These are organic compounds containing the alkyl aryl ether functional group with the generic formula R-O-R' , where R is an alkyl group and R' is an aryl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,6-bis(phenylmethoxy)pyridine |
|---|---|
| INCHI | InChI=1S/C19H17NO2/c1-3-8-16(9-4-1)14-21-18-12-7-13-19(20-18)22-15-17-10-5-2-6-11-17/h1-13H,14-15H2 |
| InChIKey | IREZYNKPQCIUME-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)COC2=NC(=CC=C2)OCC3=CC=CC=C3 |
| Isomeric SMILES | C1=CC=C(C=C1)COC2=NC(=CC=C2)OCC3=CC=CC=C3 |
| Molecular Weight | 291.3 |
| Reaxy-Rn | 1543124 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1543124&ln= |
| Molecular Weight | 291.300 g/mol |
|---|---|
| XLogP3 | 4.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 6 |
| Exact Mass | 291.126 Da |
| Monoisotopic Mass | 291.126 Da |
| Topological Polar Surface Area | 31.400 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 270.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |