Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D172346-250mg
|
250mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$626.90
|
|
Discover 2,5-dioxa-8-azaspiro[3.5]nonane hemioxalate by Aladdin Scientific in 97% for only $626.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2,5-Dioxa-8-azaspiro[3.5]nonane | 1184185-17-8 | SCHEMBL18442615 | DTXSID40676743 | AKOS006324080 | KS-9371 | CS-0047523 | 2,5-DIOXA-8-AZA-SPIRO[3,5]NONANE | F2147-8621 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Oxazinanes |
| Subclass | Morpholines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Morpholines |
| Alternative Parents | Oxetanes Oxacyclic compounds Dialkylamines Dialkyl ethers Azacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Morpholine - Oxetane - Oxacycle - Azacycle - Secondary amine - Ether - Secondary aliphatic amine - Dialkyl ether - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Amine - Aliphatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as morpholines. These are organic compounds containing a morpholine moiety, which consists of a six-member aliphatic saturated ring with the formula C4H9NO, where the oxygen and nitrogen atoms lie at positions 1 and 4, respectively. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2,5-dioxa-8-azaspiro[3.5]nonane |
|---|---|
| INCHI | InChI=1S/C6H11NO2/c1-2-9-6(3-7-1)4-8-5-6/h7H,1-5H2 |
| InChIKey | IOSOHRRBMBVUNY-UHFFFAOYSA-N |
| Smiles | C1COC2(CN1)COC2 |
| Isomeric SMILES | C1COC2(CN1)COC2 |
| Molecular Weight | 348.352 |
| Reaxy-Rn | 30895924 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=30895924&ln= |
| Molecular Weight | 129.160 g/mol |
|---|---|
| XLogP3 | -1.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 129.079 Da |
| Monoisotopic Mass | 129.079 Da |
| Topological Polar Surface Area | 30.500 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 112.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |