Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D106345-25ml
|
25ml |
3
|
$37.90
|
|
|
D106345-100ml
|
100ml |
5
|
$106.90
|
|
|
D106345-500ml
|
500ml |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$320.90
|
|
| Synonyms | FEMA 3272 | FT-0610477 | 2,5-Dimethyl pyrazine | MFCD00006147 | AC-10703 | Z104477264 | D2171 | HY-34439 | InChI=1/C6H8N2/c1-5-3-8-6(2)4-7-5/h3-4H,1-2H | NCGC00184236-02 | 2,5-Dimethylpyrazine (contains 2,6-isomer) | F0001-0364 | AKOS003368403 | AMY23196 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Argon charged |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Diazines |
| Subclass | Pyrazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrazines |
| Alternative Parents | Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrazine - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrazines. These are compounds containing a pyrazine ring, which is a six-member aromatic heterocycle, that consists of two nitrogen atoms (at positions 1 and 4) and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| Pubchem Sid | 504753439 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504753439 |
| IUPAC Name | 2,5-dimethylpyrazine |
| INCHI | InChI=1S/C6H8N2/c1-5-3-8-6(2)4-7-5/h3-4H,1-2H3 |
| InChIKey | LCZUOKDVTBMCMX-UHFFFAOYSA-N |
| Smiles | CC1=CN=C(C=N1)C |
| Isomeric SMILES | CC1=CN=C(C=N1)C |
| WGK Germany | 3 |
| RTECS | UQ2800000 |
| Molecular Weight | 108.14 |
| Beilstein | 107052 |
| Reaxy-Rn | 107052 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=107052&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Dec 16, 2024 | D106345 | |
| Certificate of Analysis | Apr 27, 2024 | D106345 | |
| Certificate of Analysis | Dec 10, 2021 | D106345 | |
| Certificate of Analysis | Dec 10, 2021 | D106345 | |
| Certificate of Analysis | Dec 10, 2021 | D106345 | |
| Certificate of Analysis | Dec 10, 2021 | D106345 | |
| Certificate of Analysis | Dec 10, 2021 | D106345 |
| Solubility | soluble in ethanol and ether |
|---|---|
| Sensitivity | Moisture sensitive.Air sensitive |
| Refractive Index | 1.4970-1.5010 |
| Flash Point(°F) | 147.2 °F |
| Flash Point(°C) | 63℃ |
| Boil Point(°C) | 155°C |
| Melt Point(°C) | 15°C |
| Molecular Weight | 108.140 g/mol |
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 108.069 Da |
| Monoisotopic Mass | 108.069 Da |
| Topological Polar Surface Area | 25.800 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 62.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
Starting at $69.90