Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B301173-1g
|
1g |
1
|
$103.90
|
|
|
B301173-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$344.90
|
|
| Synonyms | 2,5-Difluorophenyl isothiocyanate | 206559-57-1 | 1,4-Difluoro-2-isothiocyanatobenzene | Benzene, 1,4-difluoro-2-isothiocyanato- | 2,5-difluorophenylisothiocyanate | MFCD00041046 | SCHEMBL1457805 | DTXSID60344659 | QVIDXDRFMDPVLA-UHFFFAOYSA-N | Benzonitrile, 3-ethoxy-4-hyd |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Aryl fluorides Isothiocyanates Propargyl-type 1,3-dipolar organic compounds Organopnictogen compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Fluorobenzene - Aryl halide - Aryl fluoride - Isothiocyanate - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,4-difluoro-2-isothiocyanatobenzene |
|---|---|
| INCHI | InChI=1S/C7H3F2NS/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| InChIKey | QVIDXDRFMDPVLA-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(C=C1F)N=C=S)F |
| Isomeric SMILES | C1=CC(=C(C=C1F)N=C=S)F |
| WGK Germany | 3 |
| Molecular Weight | 171.17 |
| Beilstein | 6919911 |
| Reaxy-Rn | 6919911 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=6919911&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 07, 2023 | B301173 |
| Sensitivity | Moisture sensitive;heat sensitive |
|---|---|
| Refractive Index | 1.602(lit.) |
| Flash Point(°F) | 197.6 °F |
| Flash Point(°C) | 92 °C |
| Boil Point(°C) | 205 °C(lit.) |
| Molecular Weight | 171.170 g/mol |
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 170.995 Da |
| Monoisotopic Mass | 170.995 Da |
| Topological Polar Surface Area | 44.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 179.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |