Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
F188415-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,958.90
|
|
Discover 2-(4-Fluorophenyl)-2-methylpropanoic acid by Aladdin Scientific in 96% for only $1,958.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 2-(4-fluorophenyl)-2-methylpropanoic acid | 93748-19-7 | MFCD11036916 | SCHEMBL1421745 | DTXSID20603193 | IOSAIRIBZLAABD-UHFFFAOYSA-N | BCP10072 | AC7352 | AKOS000745559 | 2-(4-fluorophenyl)-2-methylpropanoicacid | BS-24617 | SY023511 | 2-(4-Fluorophenyl)-2-methylpropionic acid | |
|---|---|
| Specifications & Purity | ≥96% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylpropanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpropanes |
| Alternative Parents | Fluorobenzenes Aryl fluorides Monocarboxylic acids and derivatives Carboxylic acids Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylpropane - Fluorobenzene - Halobenzene - Aryl fluoride - Aryl halide - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Organooxygen compound - Hydrocarbon derivative - Organic oxygen compound - Carbonyl group - Organic oxide - Organohalogen compound - Organofluoride - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpropanes. These are organic compounds containing a phenylpropane moiety. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(4-fluorophenyl)-2-methylpropanoic acid |
|---|---|
| INCHI | InChI=1S/C10H11FO2/c1-10(2,9(12)13)7-3-5-8(11)6-4-7/h3-6H,1-2H3,(H,12,13) |
| InChIKey | IOSAIRIBZLAABD-UHFFFAOYSA-N |
| Smiles | CC(C)(C1=CC=C(C=C1)F)C(=O)O |
| Isomeric SMILES | CC(C)(C1=CC=C(C=C1)F)C(=O)O |
| Molecular Weight | 182.2 |
| Reaxy-Rn | 15597013 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=15597013&ln= |
| Molecular Weight | 182.190 g/mol |
|---|---|
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 182.074 Da |
| Monoisotopic Mass | 182.074 Da |
| Topological Polar Surface Area | 37.300 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 193.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |