Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D123281-5g
|
5g |
3
|
$78.90
|
|
|
D123281-25g
|
25g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$302.90
|
|
| Synonyms | (2,4-Diaminopteridin-6-yl)methanolhydrochloridehydrate | BCP09302 | MFCD00191246 | SY063959 | 2,4-Diamino-6-(hydroxymethyl)pteridine HCl | (2,4-diaminopteridin-6-yl)methanol Hydrochloride | W-200498 | (2,4-Diamino-6-pteridinyl)methanol hydrochloride | 2,4 |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
| Product Description |
Reactant involved in the synthesis of prodrugs |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pteridines and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pteridines and derivatives |
| Alternative Parents | Aminopyrimidines and derivatives Pyrazines Imidolactams Heteroaromatic compounds Azacyclic compounds Primary amines Primary alcohols Organopnictogen compounds Hydrochlorides Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Pteridine - Aminopyrimidine - Pyrazine - Pyrimidine - Imidolactam - Heteroaromatic compound - Azacycle - Hydrochloride - Alcohol - Aromatic alcohol - Hydrocarbon derivative - Organopnictogen compound - Organic oxygen compound - Primary amine - Primary alcohol - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Amine - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as pteridines and derivatives. These are polycyclic aromatic compounds containing a pteridine moiety, which consists of a pyrimidine fused to a pyrazine ring to form pyrimido(4,5-b)pyrazine. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504760944 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504760944 |
| IUPAC Name | (2,4-diaminopteridin-6-yl)methanol;hydrochloride |
| INCHI | InChI=1S/C7H8N6O.ClH/c8-5-4-6(13-7(9)12-5)10-1-3(2-14)11-4;/h1,14H,2H2,(H4,8,9,10,12,13);1H |
| InChIKey | XZHMPUJCSYVIQL-UHFFFAOYSA-N |
| Smiles | C1=C(N=C2C(=NC(=NC2=N1)N)N)CO.Cl |
| Isomeric SMILES | C1=C(N=C2C(=NC(=NC2=N1)N)N)CO.Cl |
| WGK Germany | 3 |
| Molecular Weight | 228.64 |
| Reaxy-Rn | 5651057 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5651057&ln= |
| Melt Point(°C) | 220°C |
|---|---|
| Molecular Weight | 228.640 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 228.053 Da |
| Monoisotopic Mass | 228.053 Da |
| Topological Polar Surface Area | 124.000 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 203.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |