Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D169431-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$378.90
|
|
| Synonyms | 30530-44-0 | 2,4-Diamino-6-(4-fluorophenyl)-1,3,5-triazine | 6-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine | CHEMBL139399 | SCHEMBL2493658 | DTXSID60464366 | MFCD00737286 | AKOS015894736 | SB73355 | CS-0360888 | FT-0692830 | A18612 | 6-(4-fluorophenyl)-2,4-diamino-1,3,5-triazine |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Triazines |
| Subclass | Aminotriazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,3,5-triazine-2,4-diamines |
| Alternative Parents | Fluorobenzenes Aryl fluorides 1,3,5-triazines Heteroaromatic compounds Azacyclic compounds Primary amines Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2,4-diamine-s-triazine - Fluorobenzene - Halobenzene - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - 1,3,5-triazine - Benzenoid - Heteroaromatic compound - Azacycle - Organohalogen compound - Organonitrogen compound - Primary amine - Amine - Hydrocarbon derivative - Organic nitrogen compound - Organofluoride - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,3,5-triazine-2,4-diamines. These are aromatic compounds containing a 1,3,5-triazine ring which is 2,4-disusbtituted wit amine groups. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 6-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| INCHI | InChI=1S/C9H8FN5/c10-6-3-1-5(2-4-6)7-13-8(11)15-9(12)14-7/h1-4H,(H4,11,12,13,14,15) |
| InChIKey | UPQUQQDAZPFXCH-UHFFFAOYSA-N |
| Smiles | C1=CC(=CC=C1C2=NC(=NC(=N2)N)N)F |
| Isomeric SMILES | C1=CC(=CC=C1C2=NC(=NC(=N2)N)N)F |
| WGK Germany | 3 |
| Molecular Weight | 205.19 |
| Reaxy-Rn | 523123 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=523123&ln= |
| Molecular Weight | 205.190 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 205.076 Da |
| Monoisotopic Mass | 205.076 Da |
| Topological Polar Surface Area | 90.700 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 197.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |