Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B302197-25g
|
25g |
3
|
$25.90
|
|
|
B302197-100g
|
100g |
3
|
$92.90
|
|
|
B302197-500g
|
500g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$192.90
|
|
| Synonyms | SCHEMBL35527 | 2,4-bis[(dodecylthio)methyl]-6-methylphenol | Antioxidant 1726 | FT-0697310 | Phenol, 2,4-bis((dodecylthio)methyl)-6-methyl- | UNII-HUC0447MPD | D97676 | Irganox 1726 | HUC0447MPD | BIS((DODECYLTHIO)METHYL)-6-METHYLPHENOL, 2,4- | MFCD119736 |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenols |
| Subclass | Cresols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Ortho cresols |
| Alternative Parents | Toluenes Sulfenyl compounds Dialkylthioethers Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | O-cresol - Toluene - Monocyclic benzene moiety - Dialkylthioether - Sulfenyl compound - Thioether - Organic oxygen compound - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as ortho cresols. These are organic compounds containing an ortho-cresol moiety, which consists of a benzene bearing one hydroxyl group at ring positions 1 and 2, respectively. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504764312 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504764312 |
| IUPAC Name | 2,4-bis(dodecylsulfanylmethyl)-6-methylphenol |
| INCHI | InChI=1S/C33H60OS2/c1-4-6-8-10-12-14-16-18-20-22-24-35-28-31-26-30(3)33(34)32(27-31)29-36-25-23-21-19-17-15-13-11-9-7-5-2/h26-27,34H,4-25,28-29H2,1-3H3 |
| InChIKey | VTFXHGBOGGGYDO-UHFFFAOYSA-N |
| Smiles | CCCCCCCCCCCCSCC1=CC(=C(C(=C1)C)O)CSCCCCCCCCCCCC |
| Isomeric SMILES | CCCCCCCCCCCCSCC1=CC(=C(C(=C1)C)O)CSCCCCCCCCCCCC |
| Molecular Weight | 536.96 |
| Reaxy-Rn | 18389704 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18389704&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jun 12, 2024 | B302197 | |
| Certificate of Analysis | Jun 12, 2024 | B302197 | |
| Certificate of Analysis | Jun 12, 2024 | B302197 |
| Solubility | Soluble in Acetone |
|---|---|
| Flash Point(°C) | 301 °C |
| Melt Point(°C) | 30 °C |
| Molecular Weight | 537.000 g/mol |
| XLogP3 | 14.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 26 |
| Exact Mass | 536.409 Da |
| Monoisotopic Mass | 536.409 Da |
| Topological Polar Surface Area | 70.800 Ų |
| Heavy Atom Count | 36 |
| Formal Charge | 0 |
| Complexity | 443.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |