Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
A151444-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$434.90
|
|
| Synonyms | 71311-83-6 | 2-(4-Aminophenoxy)naphthalene | 4-(naphthalen-2-yloxy)aniline | 4-naphthalen-2-yloxyaniline | 4-(2-naphthyloxy)aniline | Benzenamine, 4-(2-naphthalenyloxy)- | Oprea1_218318 | SCHEMBL1177704 | DTXSID50393853 | FLSZEMCAUKGBBK-UHFFFAOYSA-N | 4-(2-Naphthalenyloxy)-b |
|---|---|
| Specifications & Purity | ≥98%(GC)(T) |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diarylethers |
| Alternative Parents | Naphthalenes Phenoxy compounds Phenol ethers Aniline and substituted anilines Primary amines Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Diaryl ether - Naphthalene - Phenoxy compound - Aniline or substituted anilines - Phenol ether - Benzenoid - Monocyclic benzene moiety - Organic nitrogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Amine - Aromatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as diarylethers. These are organic compounds containing the dialkyl ether functional group, with the formula ROR', where R and R' are aryl groups. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 4-naphthalen-2-yloxyaniline |
|---|---|
| INCHI | InChI=1S/C16H13NO/c17-14-6-9-15(10-7-14)18-16-8-5-12-3-1-2-4-13(12)11-16/h1-11H,17H2 |
| InChIKey | FLSZEMCAUKGBBK-UHFFFAOYSA-N |
| Smiles | C1=CC=C2C=C(C=CC2=C1)OC3=CC=C(C=C3)N |
| Isomeric SMILES | C1=CC=C2C=C(C=CC2=C1)OC3=CC=C(C=C3)N |
| Molecular Weight | 235.29 |
| Reaxy-Rn | 2843077 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2843077&ln= |
| Molecular Weight | 235.280 g/mol |
|---|---|
| XLogP3 | 4.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 235.1 Da |
| Monoisotopic Mass | 235.1 Da |
| Topological Polar Surface Area | 35.300 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 260.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |