Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
T122882-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$3,434.90
|
|
| Synonyms | 2,4,6-Trifluorophenyl isocyanate | 50528-80-8 | 1,3,5-trifluoro-2-isocyanatobenzene | 2,4,6-Trifluorophenylisocyanate | C7H2F3NO | MFCD03426028 | Benzene, 1,3,5-trifluoro-2-isocyanato- | SCHEMBL160448 | DTXSID90382524 | XORSGSHLSDFOHP-UHFFFAOYSA-N | AMY14502 | BBL103008 | GEO-02 |
|---|---|
| Specifications & Purity | technical grade, ≥85% |
| Shipped In | Normal |
| Grade | technical grade |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorobenzenes |
| Alternative Parents | Aryl fluorides Isocyanates Propargyl-type 1,3-dipolar organic compounds Organopnictogen compounds Organooxygen compounds Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Fluorobenzene - Aryl fluoride - Aryl halide - Isocyanate - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Organic nitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as fluorobenzenes. These are compounds containing one or more fluorine atoms attached to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,3,5-trifluoro-2-isocyanatobenzene |
|---|---|
| INCHI | InChI=1S/C7H2F3NO/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| InChIKey | XORSGSHLSDFOHP-UHFFFAOYSA-N |
| Smiles | C1=C(C=C(C(=C1F)N=C=O)F)F |
| Isomeric SMILES | C1=C(C=C(C(=C1F)N=C=O)F)F |
| PubChem CID | 2783237 |
| Molecular Weight | 173.09 |
| Beilstein | 6325663 |
| Sensitivity | Moisture Sensitive |
|---|---|
| Refractive Index | 1.476 |
| Molecular Weight | 173.090 g/mol |
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 173.009 Da |
| Monoisotopic Mass | 173.009 Da |
| Topological Polar Surface Area | 29.400 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 193.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |