Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B301180-1g
|
1g |
1
|
$103.90
|
|
|
B301180-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$343.90
|
|
| Synonyms | 2,4,5-Trichlorophenyl isothiocyanate | 23165-46-0 | 1,2,4-Trichloro-5-isothiocyanatobenzene | Benzene, 1,2,4-trichloro-5-isothiocyanato- | 2,4,5-Trichlorophenylisothiocyanate | EINECS 245-471-5 | SCHEMBL1457091 | L-Phenylalanineallylestertosylate | DTXSID40177745 | MFCD000 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Store at 2-8°C,Argon charged |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chlorobenzenes |
| Alternative Parents | Aryl chlorides Isothiocyanates Propargyl-type 1,3-dipolar organic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Chlorobenzene - Aryl halide - Aryl chloride - Isothiocyanate - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as chlorobenzenes. These are compounds containing one or more chlorine atoms attached to a benzene moiety. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1,2,4-trichloro-5-isothiocyanatobenzene |
|---|---|
| INCHI | InChI=1S/C7H2Cl3NS/c8-4-1-6(10)7(11-3-12)2-5(4)9/h1-2H |
| InChIKey | PJLRSYLEFZNICX-UHFFFAOYSA-N |
| Smiles | C1=C(C(=CC(=C1Cl)Cl)Cl)N=C=S |
| Isomeric SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)N=C=S |
| WGK Germany | 3 |
| Molecular Weight | 238.52 |
| Beilstein | 881221 |
| Reaxy-Rn | 881221 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=881221&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 18, 2024 | B301180 | |
| Certificate of Analysis | Apr 18, 2024 | B301180 | |
| Certificate of Analysis | Apr 18, 2024 | B301180 |
| Sensitivity | Moisture sensitive |
|---|---|
| Boil Point(°C) | 141-142℃/1mmHg |
| Melt Point(°C) | 42-47°C |
| Molecular Weight | 238.500 g/mol |
| XLogP3 | 5.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 236.897 Da |
| Monoisotopic Mass | 236.897 Da |
| Topological Polar Surface Area | 44.500 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 205.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |