Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D113531-25g
|
25g |
3
|
$33.90
|
|
|
D113531-50g
|
50g |
1
|
$59.90
|
|
|
D113531-100g
|
100g |
5
|
$107.90
|
|
|
D113531-500g
|
500g |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$242.90
|
|
| Synonyms | 1,2-Dichloro-3-methylbenzene # | SCHEMBL28351 | EN300-118169 | 1,2-Dichloro-3-methylbenzene | SCHEMBL10520742 | AKOS015888478 | DTXSID0067717 | A821402 | Benzene, 1,2-dichloro-3-methyl- | EINECS 251-203-8 | 2,3-Dichlorotoluene, analytical standard | W-106 |
|---|---|
| Specifications & Purity | ≥98% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | Toluenes Aryl chlorides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 1,2-dichlorobenzene - Toluene - Aryl halide - Aryl chloride - Hydrocarbon derivative - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488183252 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488183252 |
| IUPAC Name | 1,2-dichloro-3-methylbenzene |
| INCHI | InChI=1S/C7H6Cl2/c1-5-3-2-4-6(8)7(5)9/h2-4H,1H3 |
| InChIKey | GWLKCPXYBLCEKC-UHFFFAOYSA-N |
| Smiles | CC1=C(C(=CC=C1)Cl)Cl |
| Isomeric SMILES | CC1=C(C(=CC=C1)Cl)Cl |
| WGK Germany | 3 |
| UN Number | 2238 |
| Molecular Weight | 161.03 |
| Beilstein | 2412384 |
| Reaxy-Rn | 2412384 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2412384&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Mar 06, 2024 | D113531 | |
| Certificate of Analysis | May 09, 2023 | D113531 | |
| Certificate of Analysis | Apr 08, 2023 | D113531 |
| Solubility | Insoluble in water |
|---|---|
| Freezing Point(°C) | 4 °C |
| Refractive Index | 1.55-1.552 |
| Flash Point(°F) | 83℃ |
| Flash Point(°C) | 83℃ |
| Boil Point(°C) | 207-208°C |
| Melt Point(°C) | 6°C |
| Molecular Weight | 161.030 g/mol |
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 159.985 Da |
| Monoisotopic Mass | 159.985 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 92.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |