Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B188615-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$413.90
|
|
| Synonyms | 2-(3-Bromophenyl)-1-(pyrrolidin-1-yl)ethanone | 951884-73-4 | 2-(3-Bromophenyl)-1-(pyrrolidin-1-yl)ethan-1-one | 2-(3-bromophenyl)-1-pyrrolidin-1-ylethanone | 1-[(3-Bromophenyl)acetyl]pyrrolidine | SCHEMBL3419983 | DTXSID60650085 | BNB88473 | MFCD09800919 | AKOS011897352 | P |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Phenylacetamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylacetamides |
| Alternative Parents | N-acylpyrrolidines Bromobenzenes Aryl bromides Tertiary carboxylic acid amides Azacyclic compounds Organonitrogen compounds Organobromides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylacetamide - N-acylpyrrolidine - Bromobenzene - Halobenzene - Aryl bromide - Aryl halide - Tertiary carboxylic acid amide - Pyrrolidine - Carboxamide group - Carboxylic acid derivative - Azacycle - Organoheterocyclic compound - Organohalogen compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organobromide - Organonitrogen compound - Organooxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylacetamides. These are amide derivatives of phenylacetic acids. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(3-bromophenyl)-1-pyrrolidin-1-ylethanone |
|---|---|
| INCHI | InChI=1S/C12H14BrNO/c13-11-5-3-4-10(8-11)9-12(15)14-6-1-2-7-14/h3-5,8H,1-2,6-7,9H2 |
| InChIKey | FAWHDSQLJDVROW-UHFFFAOYSA-N |
| Smiles | C1CCN(C1)C(=O)CC2=CC(=CC=C2)Br |
| Isomeric SMILES | C1CCN(C1)C(=O)CC2=CC(=CC=C2)Br |
| Molecular Weight | 268.2 |
| Reaxy-Rn | 20255929 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=20255929&ln= |
| Molecular Weight | 268.150 g/mol |
|---|---|
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 267.026 Da |
| Monoisotopic Mass | 267.026 Da |
| Topological Polar Surface Area | 20.300 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 226.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |