Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D478574-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$606.90
|
|
| Synonyms | BS-36828 | MFCD11053946 | 1060817-28-8 | 2-(3,5-DIMETHYL-1H-1,2,4-TRIAZOL-1-YL)-1-PROPANOL | 2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)propan-1-ol | DTXSID30672451 | 2-(3,5-DIMETHYL-1,2,4-TRIAZOL-1-YL)PROPAN-1-OL | 2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)-1-pro |
|---|---|
| Specifications & Purity | Reagent grade |
| Grade | Reagent Grade |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Triazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Triazoles |
| Alternative Parents | Heteroaromatic compounds Azacyclic compounds Primary alcohols Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Heteroaromatic compound - 1,2,4-triazole - Azacycle - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Primary alcohol - Organooxygen compound - Organonitrogen compound - Alcohol - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as triazoles. These are compounds containing a five-member aromatic ring of two carbon atoms and three nitrogen atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)propan-1-ol |
|---|---|
| INCHI | InChI=1S/C7H13N3O/c1-5(4-11)10-7(3)8-6(2)9-10/h5,11H,4H2,1-3H3 |
| InChIKey | NMMHSVSXQKZFIU-UHFFFAOYSA-N |
| Smiles | CC1=NN(C(=N1)C)C(C)CO |
| Isomeric SMILES | CC1=NN(C(=N1)C)C(C)CO |
| WGK Germany | 3 |
| PubChem CID | 45791173 |
| Molecular Weight | 155.2 |
| Molecular Weight | 155.200 g/mol |
|---|---|
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 155.106 Da |
| Monoisotopic Mass | 155.106 Da |
| Topological Polar Surface Area | 50.900 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 131.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |