Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
H184554-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$435.90
|
|
Discover 2-(2-Hydroxyethylamino)nicotinonitrile by Aladdin Scientific in 96% for only $435.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 440102-32-9 | 2-((2-Hydroxyethyl)amino)nicotinonitrile | 2-(2-Hydroxyethylamino)nicotinonitrile | 2-[(2-hydroxyethyl)amino]nicotinonitrile | 2-[(2-hydroxyethyl)amino]pyridine-3-carbonitrile | 2-(2-hydroxyethylamino)pyridine-3-carbonitrile | SCHEMBL6697261 | DTXSID30591 |
|---|---|
| Specifications & Purity | ≥96% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Pyridines and derivatives |
| Subclass | 3-pyridinecarbonitriles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 3-pyridinecarbonitriles |
| Alternative Parents | Aminopyridines and derivatives Imidolactams Heteroaromatic compounds Nitriles Azacyclic compounds Alkanolamines Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 3-pyridinecarbonitrile - Aminopyridine - Imidolactam - Heteroaromatic compound - Alkanolamine - Carbonitrile - Nitrile - Azacycle - Alcohol - Primary alcohol - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Cyanide - Organic oxygen compound - Amine - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 3-pyridinecarbonitriles. These are organic compounds containing a pyridine ring substituted at the 3-position by a carbonitrile group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-(2-hydroxyethylamino)pyridine-3-carbonitrile |
|---|---|
| INCHI | InChI=1S/C8H9N3O/c9-6-7-2-1-3-10-8(7)11-4-5-12/h1-3,12H,4-5H2,(H,10,11) |
| InChIKey | WSLQHHGQBZIPEU-UHFFFAOYSA-N |
| Smiles | C1=CC(=C(N=C1)NCCO)C#N |
| Isomeric SMILES | C1=CC(=C(N=C1)NCCO)C#N |
| Molecular Weight | 163.2 |
| Reaxy-Rn | 11460656 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=11460656&ln= |
| Molecular Weight | 163.180 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 163.075 Da |
| Monoisotopic Mass | 163.075 Da |
| Topological Polar Surface Area | 68.900 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 174.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |