Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D194933-250mg
|
250mg |
3
|
$21.90
|
|
|
D194933-1g
|
1g |
3
|
$71.90
|
|
|
D194933-5g
|
5g |
3
|
$283.90
|
|
|
D194933-25g
|
25g |
1
|
$1,275.90
|
|
| Synonyms | 2,2-dimethylcyclopropanecarboxylic acid | 75885-59-5 | 2,2-dimethylcyclopropane-1-carboxylic acid | 2,2-Dimethyl cyclopropyl carboxylic acid | 931-26-0 | 2,2-Dimethylcyclopropylcarboxylic acid | 2,2-dimethyl-1-cyclopropanecarboxylic acid | MFCD04972493 | MFCD08460918 | NSC |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Store at 2-8°C |
| Shipped In |
Wet ice This product requires cold chain shipping. Ground and other economy services are not available. |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Cyclopropanecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclopropanecarboxylic acids |
| Alternative Parents | Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclopropanecarboxylic acid - Monocarboxylic acid or derivatives - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclopropanecarboxylic acids. These are organic compounds containing a carboxyl group attached to a cyclopropane ring. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 504758189 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758189 |
| IUPAC Name | 2,2-dimethylcyclopropane-1-carboxylic acid |
| INCHI | InChI=1S/C6H10O2/c1-6(2)3-4(6)5(7)8/h4H,3H2,1-2H3,(H,7,8) |
| InChIKey | BFNMOMYTTGHNGJ-UHFFFAOYSA-N |
| Smiles | CC1(CC1C(=O)O)C |
| Isomeric SMILES | CC1(CC1C(=O)O)C |
| Molecular Weight | 114.14 |
| Reaxy-Rn | 1853584 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1853584&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Apr 27, 2023 | D194933 | |
| Certificate of Analysis | Apr 27, 2023 | D194933 | |
| Certificate of Analysis | Apr 27, 2023 | D194933 | |
| Certificate of Analysis | Apr 27, 2023 | D194933 | |
| Certificate of Analysis | Apr 27, 2023 | D194933 | |
| Certificate of Analysis | Apr 27, 2023 | D194933 | |
| Certificate of Analysis | Apr 27, 2023 | D194933 | |
| Certificate of Analysis | Apr 27, 2023 | D194933 |
| Molecular Weight | 114.140 g/mol |
|---|---|
| XLogP3 | 1.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 114.068 Da |
| Monoisotopic Mass | 114.068 Da |
| Topological Polar Surface Area | 37.300 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 126.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |