Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B301142-100mg
|
100mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$69.90
|
|
| Synonyms | 135887-26-2 | 2,2'-Bithiophene-5-Carbonyl Chloride | 5-thiophen-2-ylthiophene-2-carbonyl chloride | [2,2'-Bithiophene]-5-carbonylchloride | [2,2'-Bithiophene]-5-carbonyl chloride | C9H5ClOS2 | SCHEMBL3054745 | DTXSID70380063 | MFCD02681915 | AKOS015912156 | FT-0609196 | 2,2/'- |
|---|---|
| Specifications & Purity | ≥95% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Bi- and oligothiophenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bi- and oligothiophenes |
| Alternative Parents | Thiophene carboxylic acids and derivatives 2,5-disubstituted thiophenes Heteroaromatic compounds Acyl chlorides Organooxygen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Bithiophene - Thiophene carboxylic acid or derivatives - 2,5-disubstituted thiophene - Heteroaromatic compound - Thiophene - Acyl halide - Acyl chloride - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as bi- and oligothiophenes. These are organic compounds containing two or more linked thiophene rings. Thiophene is a five-member aromatic ring with one sulfur and four carbon atoms. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 5-thiophen-2-ylthiophene-2-carbonyl chloride |
|---|---|
| INCHI | InChI=1S/C9H5ClOS2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5H |
| InChIKey | HTMFYRRRQQYPCA-UHFFFAOYSA-N |
| Smiles | C1=CSC(=C1)C2=CC=C(S2)C(=O)Cl |
| Isomeric SMILES | C1=CSC(=C1)C2=CC=C(S2)C(=O)Cl |
| Molecular Weight | 228.72 |
| Reaxy-Rn | 4863670 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4863670&ln= |
| Sensitivity | Moisture sensitive |
|---|---|
| Molecular Weight | 228.700 g/mol |
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 227.947 Da |
| Monoisotopic Mass | 227.947 Da |
| Topological Polar Surface Area | 73.600 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 210.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |