Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C300027-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$937.90
|
|
| Synonyms | 175202-85-4 | 2-(2-{[(4-chlorophenyl)thio]methyl}phenoxy)ethanohydrazide | 2-[2-[(4-chlorophenyl)sulfanylmethyl]phenoxy]acetohydrazide | 2-(2-(((4-Chlorophenyl)thio)methyl)phenoxy)acetohydrazide | 2-(2-[[(4-chlorophenyl)thio]methyl]phenoxy)ethanohydrazide | 2-(2-(4 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Phenol ethers |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenol ethers |
| Alternative Parents | Thiophenol ethers Phenoxy compounds Chlorobenzenes Alkylarylthioethers Alkyl aryl ethers Aryl chlorides Carboxylic acid hydrazides Sulfenyl compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Aryl thioether - Thiophenol ether - Phenol ether - Alkyl aryl ether - Alkylarylthioether - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Carboxylic acid hydrazide - Carboxylic acid derivative - Sulfenyl compound - Thioether - Ether - Organic nitrogen compound - Organohalogen compound - Organochloride - Organonitrogen compound - Organooxygen compound - Organosulfur compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Organopnictogen compound - Organic oxygen compound - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenol ethers. These are aromatic compounds containing an ether group substituted with a benzene ring. |
| External Descriptors | Not available |
|
|
|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 2-[2-[(4-chlorophenyl)sulfanylmethyl]phenoxy]acetohydrazide |
|---|---|
| INCHI | InChI=1S/C15H15ClN2O2S/c16-12-5-7-13(8-6-12)21-10-11-3-1-2-4-14(11)20-9-15(19)18-17/h1-8H,9-10,17H2,(H,18,19) |
| InChIKey | OZJNLFBIXACHOQ-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C(=C1)CSC2=CC=C(C=C2)Cl)OCC(=O)NN |
| Isomeric SMILES | C1=CC=C(C(=C1)CSC2=CC=C(C=C2)Cl)OCC(=O)NN |
| PubChem CID | 2778909 |
| Molecular Weight | 322.82 |
| Molecular Weight | 322.800 g/mol |
|---|---|
| XLogP3 | 3.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 6 |
| Exact Mass | 322.054 Da |
| Monoisotopic Mass | 322.054 Da |
| Topological Polar Surface Area | 89.700 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 325.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |