Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I303431-25g
|
25g |
4
|
$369.90
|
|
|
I303431-100g
|
100g |
2
|
$1,113.90
|
|
Discover 17-Iodoandrosta-5,16-dien-3beta-ol by Aladdin Scientific in 98% for only $369.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 32138-69-5 | 17-Iodoandrosta-5,16-dien-3beta-ol | (3S,8R,9S,10R,13S,14S)-17-Iodo-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | (3beta)-17-Iodoandrosta-5,16-dien-3-ol | (3S,8R,9S,10R,13S,14S)-17-iodo-10,13-dimethyl-2,3 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature,Desiccated |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Steroids and steroid derivatives |
| Subclass | Androstane steroids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Androgens and derivatives |
| Alternative Parents | Halogenated steroids 3-beta-hydroxysteroids 3-beta-hydroxy delta-5-steroids Delta-5-steroids Secondary alcohols Cyclic alcohols and derivatives Vinyl iodides Iodoalkenes Organoiodides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Androgen-skeleton - 3-hydroxy-delta-5-steroid - 3-hydroxysteroid - 3-beta-hydroxysteroid - 3-beta-hydroxy-delta-5-steroid - 17-halo-steroid - Halo-steroid - Hydroxysteroid - Delta-5-steroid - Cyclic alcohol - Secondary alcohol - Vinyl halide - Vinyl iodide - Haloalkene - Iodoalkene - Organoiodide - Organohalogen compound - Organic oxygen compound - Alcohol - Hydrocarbon derivative - Organooxygen compound - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. They also show profound effects on scalp and body hair in humans. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488197122 |
|---|---|
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-17-iodo-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| INCHI | InChI=1S/C19H27IO/c1-18-9-7-13(21)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18/h3,6,13-16,21H,4-5,7-11H2,1-2H3/t13-,14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | DHZJEYGWSNDRGN-USOAJAOKSA-N |
| Smiles | CC12CCC(CC1=CCC3C2CCC4(C3CC=C4I)C)O |
| Isomeric SMILES | C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC=C4I)C)O |
| Molecular Weight | 398.33 |
| Reaxy-Rn | 2058657 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2058657&ln= |
| Molecular Weight | 398.300 g/mol |
|---|---|
| XLogP3 | 4.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 398.111 Da |
| Monoisotopic Mass | 398.111 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 522.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 6 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |