Determine the necessary mass, volume, or concentration for preparing a solution.
Il s'agit d'un magasin de démonstration. Aucune commande ne sera honorée.
SKU | Taille | Disponibilité |
Prix | Qté |
---|---|---|---|---|
P290170-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
3 324,90$US
|
|
Spécifications et pureté | sublimed grade, ≥99%(HPLC) |
---|---|
Grade | sublimed grade |
IUPAC Name | 10-phenylspiro[acridine-9,10'-anthracene]-9'-one |
---|---|
INCHI | InChI=1S/C32H21NO/c34-31-23-14-4-6-16-25(23)32(26-17-7-5-15-24(26)31)27-18-8-10-20-29(27)33(22-12-2-1-3-13-22)30-21-11-9-19-28(30)32/h1-21H |
InChIKey | ASXSTQHYXCIZRV-UHFFFAOYSA-N |
Smiles | C1=CC=C(C=C1)N2C3=CC=CC=C3C4(C5=CC=CC=C5C(=O)C6=CC=CC=C64)C7=CC=CC=C72 |
Isomères SMILES | C1=CC=C(C=C1)N2C3=CC=CC=C3C4(C5=CC=CC=C5C(=O)C6=CC=CC=C64)C7=CC=CC=C72 |
PubChem CID | 59156120 |