Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
Z165702-1g
|
1g |
3
|
$20.90
|
|
|
Z165702-5g
|
5g |
1
|
$90.90
|
|
| Synonyms | FT-0766133 | DTXSID00455096 | N-Cbz-2-piperidinone | N-(benzyloxycarbonyl)piperidone | AMY20740 | A50795 | LKGMGCSFOUSKCR-UHFFFAOYSA-N | Benzyl 2-oxopiperidine-1-carboxylate | MFCD09908205 | AKOS015890735 | SCHEMBL520364 | 1-Z-2-Piperidone, 95% |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzyloxycarbonyls |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzyloxycarbonyls |
| Alternative Parents | Piperidinecarboxylic acids Piperidinones Delta lactams Dicarboximides Carbamate esters Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Benzyloxycarbonyl - Piperidinecarboxylic acid - Delta-lactam - Piperidinone - Piperidine - Carbamic acid ester - Dicarboximide - Lactam - Azacycle - Organoheterocyclic compound - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzyloxycarbonyls. These are organic compounds containing a carbonyl group substituted with a benzyloxyl group. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488197162 |
|---|---|
| IUPAC Name | benzyl 2-oxopiperidine-1-carboxylate |
| INCHI | InChI=1S/C13H15NO3/c15-12-8-4-5-9-14(12)13(16)17-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2 |
| InChIKey | LKGMGCSFOUSKCR-UHFFFAOYSA-N |
| Smiles | C1CCN(C(=O)C1)C(=O)OCC2=CC=CC=C2 |
| Isomeric SMILES | C1CCN(C(=O)C1)C(=O)OCC2=CC=CC=C2 |
| WGK Germany | 3 |
| PubChem CID | 11096497 |
| Molecular Weight | 233.26 |
| Refractive Index | n20/D 1.544 |
|---|---|
| Flash Point(°F) | >230 °F |
| Flash Point(°C) | >110 °C |
| Molecular Weight | 233.260 g/mol |
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 233.105 Da |
| Monoisotopic Mass | 233.105 Da |
| Topological Polar Surface Area | 46.600 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 284.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |