Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P178517-500mg
|
500mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,869.90
|
|
| Specifications & Purity | ≥97% |
|---|---|
| Storage Temp | Room temperature |
| Shipped In | Normal |
| IUPAC Name | tert-butyl (3S,4R)-4-hydroxy-3-methylpiperidine-1-carboxylate |
|---|---|
| INCHI | InChI=1S/C11H21NO3/c1-8-7-12(6-5-9(8)13)10(14)15-11(2,3)4/h8-9,13H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | PSDMSGJMWVMEMV-DTWKUNHWSA-N |
| Smiles | CC1CN(CCC1O)C(=O)OC(C)(C)C |
| Isomeric SMILES | C[C@H]1CN(CC[C@H]1O)C(=O)OC(C)(C)C |
| PubChem CID | 68442776 |
| Molecular Weight | 215.2893 |
| Molecular Weight | 215.290 g/mol |
|---|---|
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 215.152 Da |
| Monoisotopic Mass | 215.152 Da |
| Topological Polar Surface Area | 49.800 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 234.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |