Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
P177674-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$447.90
|
|
| Synonyms | 1-phenylazetidin-3-ol | 857280-53-6 | MFCD22566181 | 1-phenyl-azetidin-3-ol | SCHEMBL2280578 | DTXSID40625650 | DAOXYMJNDJMGHK-UHFFFAOYSA-N | AMY34638 | AKOS025405103 | PB37862 | SB20162 | 3-Hydroxy-1-phenylazetidine hydrochloride | AS-51695 | SY099857 | CS-0052409 | FT-0767989 | EN300- |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azetidines |
| Subclass | Phenylazetidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylazetidines |
| Alternative Parents | Dialkylarylamines Aniline and substituted anilines Secondary alcohols 1,2-aminoalcohols Azacyclic compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 1-phenylazetidine - Tertiary aliphatic/aromatic amine - Dialkylarylamine - Aniline or substituted anilines - Benzenoid - Monocyclic benzene moiety - Tertiary amine - 1,2-aminoalcohol - Secondary alcohol - Azacycle - Amine - Alcohol - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylazetidines. These are polycyclic aromatic compounds containing a phenyl ring substituted with an azetidine ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-phenylazetidin-3-ol |
|---|---|
| INCHI | InChI=1S/C9H11NO/c11-9-6-10(7-9)8-4-2-1-3-5-8/h1-5,9,11H,6-7H2 |
| InChIKey | DAOXYMJNDJMGHK-UHFFFAOYSA-N |
| Smiles | C1C(CN1C2=CC=CC=C2)O |
| Isomeric SMILES | C1C(CN1C2=CC=CC=C2)O |
| PubChem CID | 22436526 |
| Molecular Weight | 149.193 |
| Molecular Weight | 149.190 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 149.084 Da |
| Monoisotopic Mass | 149.084 Da |
| Topological Polar Surface Area | 23.500 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 126.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |