Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
N184900-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$685.90
|
|
| Synonyms | N1-Butylbenzene-1,2-diamine | 51592-02-0 | 1-N-Butylbenzene-1,2-diamine | 2-N-butylbenzene-1,2-diamine | Butylphenylendiamin | N-butyl-2-aminoaniline | SCHEMBL659537 | DTXSID80459370 | NBFBBBHLERFOND-UHFFFAOYSA-N | BCA59202 | MFCD08689819 | AKOS009237754 | SB75950 | BS-28785 | CS-04 |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Aralkylamines |
| Direct Parent | Phenylalkylamines |
| Alternative Parents | Aniline and substituted anilines Secondary alkylarylamines Primary amines Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylalkylamine - Aniline or substituted anilines - Secondary aliphatic/aromatic amine - Benzenoid - Monocyclic benzene moiety - Secondary amine - Hydrocarbon derivative - Primary amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylalkylamines. These are organic amines where the amine group is secondary and linked on one end to a phenyl group and on the other end, to an alkyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 2-N-butylbenzene-1,2-diamine |
|---|---|
| INCHI | InChI=1S/C10H16N2/c1-2-3-8-12-10-7-5-4-6-9(10)11/h4-7,12H,2-3,8,11H2,1H3 |
| InChIKey | NBFBBBHLERFOND-UHFFFAOYSA-N |
| Smiles | CCCCNC1=CC=CC=C1N |
| Isomeric SMILES | CCCCNC1=CC=CC=C1N |
| Molecular Weight | 164.3 |
| Reaxy-Rn | 2803437 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2803437&ln= |
| Molecular Weight | 164.250 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 164.131 Da |
| Monoisotopic Mass | 164.131 Da |
| Topological Polar Surface Area | 38.100 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 114.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |