Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
M303848-50mg
|
50mg |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,224.90
|
|
| Synonyms | 1-Methyladenine | 5142-22-3 | 1-Methyl-1H-purin-6-amine | 1H-Purin-6-amine, 1-methyl- | Adenine, 1-methyl- | N1-methyladenine | 1-methyl-7H-purin-6-imine | 1-Methyl-1H-purin-6-ylamine | 98K2TG3E3W | 6H-Purin-6-imine, 1,9-dihydro-1-methyl- | CHEBI:18083 | NSC70896 | NSC-70896 | 1-M |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Imidazopyrimidines |
| Subclass | Purines and purine derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Purines and purine derivatives |
| Alternative Parents | Pyrimidines and pyrimidine derivatives Imidolactams Imidazoles Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Purine - Imidolactam - Pyrimidine - Heteroaromatic compound - Imidazole - Azole - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as purines and purine derivatives. These are aromatic heterocyclic compounds containing a purine moiety, which is formed a pyrimidine-ring ring fused to an imidazole ring. |
| External Descriptors | Not available |
|
|
|
| Mechanism of Action | Action Type | target ID | Target Name | Target Type | Target Organism | Binding Site Name | References |
|---|
| IUPAC Name | 1-methyl-7H-purin-6-imine |
|---|---|
| INCHI | InChI=1S/C6H7N5/c1-11-3-10-6-4(5(11)7)8-2-9-6/h2-3,7H,1H3,(H,8,9) |
| InChIKey | SATCOUWSAZBIJO-UHFFFAOYSA-N |
| Smiles | CN1C=NC2=C(C1=N)NC=N2 |
| Isomeric SMILES | CN1C=NC2=C(C1=N)NC=N2 |
| Molecular Weight | 149.15 |
| Reaxy-Rn | 610034 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=610034&ln= |
| Refractive Index | 1.807 |
|---|---|
| Flash Point(°C) | 99ºC |
| Melt Point(°C) | > 300ºC |
| Molecular Weight | 149.150 g/mol |
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 149.07 Da |
| Monoisotopic Mass | 149.07 Da |
| Topological Polar Surface Area | 68.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 211.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Hongyan Wang, Yurou Zhou, Jingpei Cao, Bofeng Zhang, Yajie Tian, Guozhu Liu. (2024) Effect of methyl substituent on adamantane pyrolysis at atmospheric and high pressure: A combined experimental and theoretical study. JOURNAL OF ANALYTICAL AND APPLIED PYROLYSIS, 177 (106299). |