Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C633627-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$349.90
|
|
|
C633627-5g
|
5g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,138.90
|
|
|
C633627-10g
|
10g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$2,276.90
|
|
| Synonyms | 33229-04-8 | 1-(carboxymethyl)cyclopropane-1-carboxylic acid | 1-(Carboxymethyl)cyclopropanecarboxylic acid | 1-(Carboxymethyl)cyclopropanecarboxylicacid | SCHEMBL751234 | MFCD19229096 | AKOS006377095 | AT13570 | EN300-147955 |
|---|---|
| Specifications & Purity | ≥97% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Cyclopropanecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclopropanecarboxylic acids |
| Alternative Parents | Dicarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Dicarboxylic acid or derivatives - Cyclopropanecarboxylic acid - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclopropanecarboxylic acids. These are organic compounds containing a carboxyl group attached to a cyclopropane ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-(carboxymethyl)cyclopropane-1-carboxylic acid |
|---|---|
| INCHI | InChI=1S/C6H8O4/c7-4(8)3-6(1-2-6)5(9)10/h1-3H2,(H,7,8)(H,9,10) |
| InChIKey | TYHRCGALWHXYOO-UHFFFAOYSA-N |
| Smiles | C1CC1(CC(=O)O)C(=O)O |
| Isomeric SMILES | C1CC1(CC(=O)O)C(=O)O |
| PubChem CID | 21475035 |
| Molecular Weight | 144.12 |
| Molecular Weight | 144.120 g/mol |
|---|---|
| XLogP3 | -0.400 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 144.042 Da |
| Monoisotopic Mass | 144.042 Da |
| Topological Polar Surface Area | 74.600 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 180.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |