Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B472078-250mg
|
250mg |
2
|
$301.90
|
|
|
B472078-1g
|
1g |
1
|
$1,001.90
|
|
| Synonyms | 1-Bromobutane-D9 | 1-bromo-1,1,2,2,3,3,4,4,4-nonadeuteriobutane | 1-bromo(?H?)butane | MFCD00142592 | DTXSID80481752 | 1-Bromobutane-d9, 98 atom % D | AKOS030255220 | SCHEMBL14169608 | D98936 |
|---|---|
| Specifications & Purity | ≥98 atom% D,≥99% |
| Storage Temp | Protected from light |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Class | Organobromides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organobromides |
| Alternative Parents | Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hydrocarbon derivative - Organobromide - Alkyl halide - Alkyl bromide - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as organobromides. These are compounds containing a chemical bond between a carbon atom and a bromine atom. |
| External Descriptors | Not available |
|
|
|
| Pubchem Sid | 488197974 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488197974 |
| IUPAC Name | 1-bromo-1,1,2,2,3,3,4,4,4-nonadeuteriobutane |
| INCHI | InChI=1S/C4H9Br/c1-2-3-4-5/h2-4H2,1H3/i1D3,2D2,3D2,4D2 |
| InChIKey | MPPPKRYCTPRNTB-YNSOAAEFSA-N |
| Smiles | CCCCBr |
| Isomeric SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br |
| Molecular Weight | 146.07 |
| Reaxy-Rn | 1098260 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1098260&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Jul 26, 2023 | B472078 | |
| Certificate of Analysis | Jul 26, 2023 | B472078 | |
| Certificate of Analysis | Jul 26, 2023 | B472078 | |
| Certificate of Analysis | Jul 26, 2023 | B472078 |
| Sensitivity | Light sensitive;Moisture sensitive |
|---|---|
| Boil Point(°C) | 100-104 °C (lit.) |
| Melt Point(°C) | -112 °C (lit.) |
| Molecular Weight | 146.070 g/mol |
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 2 |
| Exact Mass | 145.045 Da |
| Monoisotopic Mass | 145.045 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 5 |
| Formal Charge | 0 |
| Complexity | 13.100 |
| Isotope Atom Count | 9 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |