Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B174591-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$41.90
|
|
Discover 1-benzyl-5-nitro-1H-imidazole by Aladdin Scientific in 97% for only $41.90. Available - in Ligands at Aladdin Scientific. Tags: .
| Synonyms | 1-Benzyl-5-nitroimidazole | 159790-78-0 | 1-benzyl-5-nitro-1H-imidazole | MFCD04972447 | 1H-Imidazole, 5-nitro-1-(phenylmethyl)- | 5-NITRO-1-(PHENYLMETHYL)-1H-IMIDAZOLE | SCHEMBL17425121 | DTXSID80434142 | 5-nitro-1-(phenylmethyl)imidazole | AKOS015911484 | AB21029 | GS-5902 | S |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Imidazoles |
| Intermediate Tree Nodes | Substituted imidazoles |
| Direct Parent | Nitroimidazoles |
| Alternative Parents | Nitroaromatic compounds N-substituted imidazoles Benzene and substituted derivatives Heteroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Azacyclic compounds Organonitrogen compounds Organic salts Organic oxides Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Nitroaromatic compound - Nitroimidazole - Monocyclic benzene moiety - N-substituted imidazole - Benzenoid - Heteroaromatic compound - C-nitro compound - Organic nitro compound - Organic oxoazanium - Azacycle - Allyl-type 1,3-dipolar organic compound - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Organonitrogen compound - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organic cation - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitroimidazoles. These are compounds containing an imidazole ring which bears a nitro group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-benzyl-5-nitroimidazole |
|---|---|
| INCHI | InChI=1S/C10H9N3O2/c14-13(15)10-6-11-8-12(10)7-9-4-2-1-3-5-9/h1-6,8H,7H2 |
| InChIKey | ORVKJGIRFOONOE-UHFFFAOYSA-N |
| Smiles | C1=CC=C(C=C1)CN2C=NC=C2[N+](=O)[O-] |
| Isomeric SMILES | C1=CC=C(C=C1)CN2C=NC=C2[N+](=O)[O-] |
| Molecular Weight | 203.201 |
| Reaxy-Rn | 6924142 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=6924142&ln= |
| Molecular Weight | 203.200 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 203.069 Da |
| Monoisotopic Mass | 203.069 Da |
| Topological Polar Surface Area | 63.600 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 223.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |