Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B184427-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$170.90
|
|
| Synonyms | 41276-30-6 | ethyl 1-benzyl-4-oxopiperidine-3-carboxylate | 1-Benzyl-3-ethoxycarbonyl-4-piperidone | 1-Benzyl-3-carbethoxy-4-piperidone | 1-Benzyl-3-carboethoxy-4-piperidone | Ethyl1-benzyl-4-oxopiperidine-3-carboxylate | Ethyl 1-benzyl-4-oxo-3-piperidinecarboxylate | |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Benzylpiperidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-benzylpiperidines |
| Alternative Parents | Piperidinecarboxylic acids Phenylmethylamines Benzylamines Piperidinones Aralkylamines 1,3-dicarbonyl compounds Trialkylamines Cyclic ketones Carboxylic acid esters Amino acids and derivatives Monocarboxylic acids and derivatives Azacyclic compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | N-benzylpiperidine - Piperidinecarboxylic acid - Benzylamine - Phenylmethylamine - Piperidinone - Aralkylamine - Benzenoid - 1,3-dicarbonyl compound - Monocyclic benzene moiety - Amino acid or derivatives - Cyclic ketone - Tertiary aliphatic amine - Tertiary amine - Carboxylic acid ester - Ketone - Azacycle - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Hydrocarbon derivative - Organic oxygen compound - Organonitrogen compound - Organooxygen compound - Organopnictogen compound - Carbonyl group - Organic nitrogen compound - Organic oxide - Amine - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as n-benzylpiperidines. These are heterocyclic Compounds containing a piperidine ring conjugated to a benzyl group through one nitrogen ring atom. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | ethyl 1-benzyl-4-oxopiperidine-3-carboxylate |
|---|---|
| INCHI | InChI=1S/C15H19NO3/c1-2-19-15(18)13-11-16(9-8-14(13)17)10-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3 |
| InChIKey | ROSZJQBQGFBFSW-UHFFFAOYSA-N |
| Smiles | CCOC(=O)C1CN(CCC1=O)CC2=CC=CC=C2 |
| Isomeric SMILES | CCOC(=O)C1CN(CCC1=O)CC2=CC=CC=C2 |
| Molecular Weight | 261.3 |
| Reaxy-Rn | 227356 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=227356&ln= |
| Molecular Weight | 261.320 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 261.136 Da |
| Monoisotopic Mass | 261.136 Da |
| Topological Polar Surface Area | 46.600 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 323.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |