Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
I171273-100mg
|
100mg |
Available within 4-8 weeks(?)
Items will be manufactured post-order and can take 4-8 weeks. Thank you for your patience!
|
$100.90
|
|
| Synonyms | 1-[(4-isothiocyanatophenyl)sulfonyl]piperidine | 7356-55-0 | 1-(4-isothiocyanatophenyl)sulfonylpiperidine | Piperidine,1-[(4-isothiocyanatophenyl)sulfonyl]- | N-(4-Piperidinosulfonylphenyl)isothiocyanate | N-(4-Isothiocyanatobenzenesulfonyl)piperidine | ISOTHIOCYANIC |
|---|---|
| Specifications & Purity | ≥95% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Benzenesulfonamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzenesulfonamides |
| Alternative Parents | Benzenesulfonyl compounds Piperidines Organosulfonamides Sulfonyls Isothiocyanates Propargyl-type 1,3-dipolar organic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Benzenesulfonamide - Benzenesulfonyl group - Piperidine - Organosulfonic acid amide - Sulfonyl - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - Isothiocyanate - Azacycle - Organoheterocyclic compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organic oxygen compound - Hydrocarbon derivative - Organic nitrogen compound - Organosulfur compound - Organonitrogen compound - Organic oxide - Organopnictogen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as benzenesulfonamides. These are organic compounds containing a sulfonamide group that is S-linked to a benzene ring. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-(4-isothiocyanatophenyl)sulfonylpiperidine |
|---|---|
| INCHI | InChI=1S/C12H14N2O2S2/c15-18(16,14-8-2-1-3-9-14)12-6-4-11(5-7-12)13-10-17/h4-7H,1-3,8-9H2 |
| InChIKey | PMPSZAXEUCIVDC-UHFFFAOYSA-N |
| Smiles | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)N=C=S |
| Isomeric SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)N=C=S |
| Molecular Weight | 282.386 |
| Reaxy-Rn | 4939532 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4939532&ln= |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
| Certificate of Analysis | Sep 08, 2023 | I171273 |
| Molecular Weight | 282.400 g/mol |
|---|---|
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 282.05 Da |
| Monoisotopic Mass | 282.05 Da |
| Topological Polar Surface Area | 90.200 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 410.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |