Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
B186460-25g
|
25g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$530.90
|
|
| Synonyms | 1-(3-Bromo-4-methylphenyl)piperidine | 761001-65-4 | SCHEMBL6826402 | DTXSID30674915 | MFCD11855915 | AKOS015834619 | SB43145 | BS-22616 | CS-0207858 |
|---|---|
| Specifications & Purity | ≥98% |
| Storage Temp | Room temperature |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Piperidines |
| Subclass | Phenylpiperidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpiperidines |
| Alternative Parents | Dialkylarylamines Aniline and substituted anilines Aminotoluenes Bromobenzenes Aryl bromides Azacyclic compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpiperidine - Dialkylarylamine - Aniline or substituted anilines - Aminotoluene - Toluene - Halobenzene - Bromobenzene - Benzenoid - Monocyclic benzene moiety - Aryl halide - Aryl bromide - Tertiary amine - Azacycle - Amine - Organic nitrogen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpiperidines. These are compounds containing a phenylpiperidine skeleton, which consists of a piperidine bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | 1-(3-bromo-4-methylphenyl)piperidine |
|---|---|
| INCHI | InChI=1S/C12H16BrN/c1-10-5-6-11(9-12(10)13)14-7-3-2-4-8-14/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | NYLCUCRPNIVCSQ-UHFFFAOYSA-N |
| Smiles | CC1=C(C=C(C=C1)N2CCCCC2)Br |
| Isomeric SMILES | CC1=C(C=C(C=C1)N2CCCCC2)Br |
| Molecular Weight | 254.2 |
| Reaxy-Rn | 15692010 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=15692010&ln= |
| Molecular Weight | 254.170 g/mol |
|---|---|
| XLogP3 | 3.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 1 |
| Exact Mass | 253.047 Da |
| Monoisotopic Mass | 253.047 Da |
| Topological Polar Surface Area | 3.200 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 177.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |