Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
D304010-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$175.90
|
|
| Synonyms | 1-(3,4-dimethoxyphenyl)ethanol | 5653-65-6 | 1-(3,4-dimethoxyphenyl)ethan-1-ol | bmse010004 | MFCD02127273 | SBB063523 | 3,4-dimethoxyphenylethanol | SureCN670305 | 3,4-Dimethoxyphenyl ethanol | SCHEMBL670305 | CHEBI:86531 | DTXSID10331216 | RTWOAVKBRMACKZ-UHFFFAOYSA-N | 1-(3,4-di |
|---|---|
| Specifications & Purity | ≥97% |
| Storage Temp | Room temperature,Desiccated |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Methoxybenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dimethoxybenzenes |
| Alternative Parents | Phenoxy compounds Anisoles Alkyl aryl ethers Secondary alcohols Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | O-dimethoxybenzene - Dimethoxybenzene - Phenoxy compound - Phenol ether - Anisole - Alkyl aryl ether - Secondary alcohol - Ether - Organic oxygen compound - Hydrocarbon derivative - Aromatic alcohol - Organooxygen compound - Alcohol - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as dimethoxybenzenes. These are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. |
| External Descriptors | benzyl alcohols - dimethoxybenzene |
|
|
|
| IUPAC Name | 1-(3,4-dimethoxyphenyl)ethanol |
|---|---|
| INCHI | InChI=1S/C10H14O3/c1-7(11)8-4-5-9(12-2)10(6-8)13-3/h4-7,11H,1-3H3 |
| InChIKey | RTWOAVKBRMACKZ-UHFFFAOYSA-N |
| Smiles | CC(C1=CC(=C(C=C1)OC)OC)O |
| Isomeric SMILES | CC(C1=CC(=C(C=C1)OC)OC)O |
| Molecular Weight | 182.22 |
| Reaxy-Rn | 2048958 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2048958&ln= |
| Molecular Weight | 182.220 g/mol |
|---|---|
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 182.094 Da |
| Monoisotopic Mass | 182.094 Da |
| Topological Polar Surface Area | 38.700 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 149.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |