Determine the necessary mass, volume, or concentration for preparing a solution.
This is a demo store. No orders will be fulfilled.
| SKU | Size | Availability |
Price | Qty |
|---|---|---|---|---|
|
C179194-1g
|
1g |
Available within 8-12 weeks(?)
Production requires sourcing of materials. We appreciate your patience and understanding.
|
$1,827.90
|
|
| Synonyms | 1-(2-Chlorophenyl)pyrazole-4-boronic acid | 1072945-91-5 | [1-(2-chlorophenyl)pyrazol-4-yl]boronic acid | (1-(2-Chlorophenyl)-1H-pyrazol-4-yl)boronic acid | [1-(2-Chlorophenyl)-1H-pyrazol-4-yl]boronic acid | SCHEMBL2556004 | DTXSID70674393 | XSB94591 | MFCD09972101 | AKOS0 |
|---|---|
| Specifications & Purity | ≥96% |
| Shipped In | Normal |
Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Pyrazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyrazoles |
| Alternative Parents | Chlorobenzenes Aryl chlorides Heteroaromatic compounds Boronic acids Organic metalloid salts Azacyclic compounds Organonitrogen compounds Organometalloid compounds Organochlorides Organic oxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpyrazole - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Heteroaromatic compound - Boronic acid derivative - Boronic acid - Azacycle - Organic metalloid salt - Organochloride - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxygen compound - Organohalogen compound - Organic metalloid moeity - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as phenylpyrazoles. These are compounds containing a phenylpyrazole skeleton, which consists of a pyrazole bound to a phenyl group. |
| External Descriptors | Not available |
|
|
|
| IUPAC Name | [1-(2-chlorophenyl)pyrazol-4-yl]boronic acid |
|---|---|
| INCHI | InChI=1S/C9H8BClN2O2/c11-8-3-1-2-4-9(8)13-6-7(5-12-13)10(14)15/h1-6,14-15H |
| InChIKey | MVLVNKOFJKGBIG-UHFFFAOYSA-N |
| Smiles | B(C1=CN(N=C1)C2=CC=CC=C2Cl)(O)O |
| Isomeric SMILES | B(C1=CN(N=C1)C2=CC=CC=C2Cl)(O)O |
| Molecular Weight | 222.4 |
| Reaxy-Rn | 33633420 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=33633420&ln= |
| Molecular Weight | 222.440 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 222.037 Da |
| Monoisotopic Mass | 222.037 Da |
| Topological Polar Surface Area | 58.300 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 220.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |